C24H53FO5Si3 — CID 140966524
(3R,4R,5R,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-fluorooxan-2-ol (PubChem CID 140966524) has the molecular formula C24H53FO5Si3 and a molecular weight of 524.94 g/mol. Its IUPAC name is (3R,4R,5R,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-fluorooxan-2-ol.
| Compound Name | (3R,4R,5R,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-fluorooxan-2-ol |
|---|---|
| PubChem CID | 140966524 |
| Molecular Formula | C24H53FO5Si3 |
| Molecular Weight | 524.94 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | (3R,4R,5R,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-fluorooxan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1F |
| InChI | InChI=1S/C24H53FO5Si3/c1-22(2,3)31(10,11)27-16-17-18(25)19(29-32(12,13)23(4,5)6)20(21(26)28-17)30-33(14,15)24(7,8)9/h17-21,26H,16H2,1-15H3/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | YWUXZYJCAMKKIB-AWGDKMGJSA-N |
| XLogP | 6.84 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.94 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|