C12H13NO2 — CID 14096693
(1R,2S,6R,7S)-4-prop-2-ynyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 14096693) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-prop-2-ynyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-prop-2-ynyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 14096693 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (1R,2S,6R,7S)-4-prop-2-ynyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C#CCN1C(=O)[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C12H13NO2/c1-2-5-13-11(14)9-7-3-4-8(6-7)10(9)12(13)15/h1,7-10H,3-6H2/t7-,8+,9+,10- |
| InChIKey | FKFFIPHOZCFMQT-FIRGSJFUSA-N |
| XLogP | 0.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|