About 7-(chloromethyl)-1,3-benzothiazole
7-(chloromethyl)-1,3-benzothiazole (PubChem CID 14096730) has the molecular formula C8H6ClNS
and a molecular weight of 183.66 g/mol. Its IUPAC name is 7-(chloromethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 7-(chloromethyl)-1,3-benzothiazole |
| PubChem CID | 14096730 |
| Molecular Formula | C8H6ClNS |
| Molecular Weight | 183.66 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 7-(chloromethyl)-1,3-benzothiazole |
| SMILES | ClCc1cccc2ncsc12 |
| InChI | InChI=1S/C8H6ClNS/c9-4-6-2-1-3-7-8(6)11-5-10-7/h1-3,5H,4H2 |
| InChIKey | YSITWZBUYWTUNM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(chloromethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(chloromethyl)-1,3-benzothiazole?
The IUPAC name of 7-(chloromethyl)-1,3-benzothiazole (CID 14096730) is 7-(chloromethyl)-1,3-benzothiazole.
What is the SMILES notation for 7-(chloromethyl)-1,3-benzothiazole?
The canonical SMILES for 7-(chloromethyl)-1,3-benzothiazole is ClCc1cccc2ncsc12.
What is the InChIKey of 7-(chloromethyl)-1,3-benzothiazole?
The InChIKey is YSITWZBUYWTUNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNS/c9-4-6-2-1-3-7-8(6)11-5-10-7/h1-3,5H,4H2.
What are the key properties of 7-(chloromethyl)-1,3-benzothiazole?
7-(chloromethyl)-1,3-benzothiazole has a molecular weight of 183.66 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(chloromethyl)-1,3-benzothiazole is sourced from PubChem (CID 14096730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).