About 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene
7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene (PubChem CID 140967492) has the molecular formula C5H5NO2
and a molecular weight of 111.10 g/mol. Its IUPAC name is 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene.
Molecular Properties
| Compound Name | 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene |
| PubChem CID | 140967492 |
| Molecular Formula | C5H5NO2 |
| Molecular Weight | 111.10 g/mol |
| Exact Mass | 111.03 |
| IUPAC Name | 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene |
| SMILES | C1=CN=C2OOC2C1 |
| InChI | InChI=1S/C5H5NO2/c1-2-4-5(6-3-1)8-7-4/h1,3-4H,2H2 |
| InChIKey | LHOKSYQSMPMMTJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene?
The IUPAC name of 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene (CID 140967492) is 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene.
What is the SMILES notation for 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene?
The canonical SMILES for 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene is C1=CN=C2OOC2C1.
What is the InChIKey of 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene?
The InChIKey is LHOKSYQSMPMMTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2/c1-2-4-5(6-3-1)8-7-4/h1,3-4H,2H2.
What are the key properties of 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene?
7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene has a molecular weight of 111.10 g/mol, XLogP of 0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dioxa-2-azabicyclo[4.2.0]octa-1,3-diene is sourced from PubChem (CID 140967492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).