C29H34O6 — CID 140967669
(3R,4R,5R)-2,3,4-tribenzyl-5-[(1R)-1,2-dihydroxyethyl]-5-ethyloxolane-2,3,4-triol (PubChem CID 140967669) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is (3R,4R,5R)-2,3,4-tribenzyl-5-[(1R)-1,2-dihydroxyethyl]-5-ethyloxolane-2,3,4-triol.
| Compound Name | (3R,4R,5R)-2,3,4-tribenzyl-5-[(1R)-1,2-dihydroxyethyl]-5-ethyloxolane-2,3,4-triol |
|---|---|
| PubChem CID | 140967669 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (3R,4R,5R)-2,3,4-tribenzyl-5-[(1R)-1,2-dihydroxyethyl]-5-ethyloxolane-2,3,4-triol |
| SMILES | CC[C@]1([C@H](O)CO)OC(O)(Cc2ccccc2)[C@@](O)(Cc2ccccc2)[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C29H34O6/c1-2-26(25(31)21-30)27(32,18-22-12-6-3-7-13-22)28(33,19-23-14-8-4-9-15-23)29(34,35-26)20-24-16-10-5-11-17-24/h3-17,25,30-34H,2,18-21H2,1H3/t25-,26-,27+,28-,29?/m1/s1 |
| InChIKey | JNPQZZTXOVYMJN-XSXASNHFSA-N |
| XLogP | 2.40 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |