C10H12O2 — CID 140967789
5-methoxy-2,3,3a,4-tetrahydroinden-1-one (PubChem CID 140967789) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 5-methoxy-2,3,3a,4-tetrahydroinden-1-one.
| Compound Name | 5-methoxy-2,3,3a,4-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 140967789 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 5-methoxy-2,3,3a,4-tetrahydroinden-1-one |
| SMILES | COC1=CC=C2C(=O)CCC2C1 |
| InChI | InChI=1S/C10H12O2/c1-12-8-3-4-9-7(6-8)2-5-10(9)11/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | VEOIGOBLACFXKY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |