C16H14Br4O — CID 140967857
2,3,4,5-tetrabromo-6-(2,3,4,5-tetramethylphenyl)phenol (PubChem CID 140967857) has the molecular formula C16H14Br4O and a molecular weight of 541.90 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-6-(2,3,4,5-tetramethylphenyl)phenol.
| Compound Name | 2,3,4,5-tetrabromo-6-(2,3,4,5-tetramethylphenyl)phenol |
|---|---|
| PubChem CID | 140967857 |
| Molecular Formula | C16H14Br4O |
| Molecular Weight | 541.90 g/mol |
| Exact Mass | 537.78 |
| IUPAC Name | 2,3,4,5-tetrabromo-6-(2,3,4,5-tetramethylphenyl)phenol |
| SMILES | Cc1cc(-c2c(O)c(Br)c(Br)c(Br)c2Br)c(C)c(C)c1C |
| InChI | InChI=1S/C16H14Br4O/c1-6-5-10(9(4)8(3)7(6)2)11-12(17)13(18)14(19)15(20)16(11)21/h5,21H,1-4H3 |
| InChIKey | PZDZCEJFCOLKBI-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.90 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|