C11H12O4 — CID 140968360
2,5-dioxatricyclo[7.3.1.01,6]tridec-7-ene-3,4-dione (PubChem CID 140968360) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2,5-dioxatricyclo[7.3.1.01,6]tridec-7-ene-3,4-dione.
| Compound Name | 2,5-dioxatricyclo[7.3.1.01,6]tridec-7-ene-3,4-dione |
|---|---|
| PubChem CID | 140968360 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2,5-dioxatricyclo[7.3.1.01,6]tridec-7-ene-3,4-dione |
| SMILES | O=C1OC2C=CC3CCCC2(C3)OC1=O |
| InChI | InChI=1S/C11H12O4/c12-9-10(13)15-11-5-1-2-7(6-11)3-4-8(11)14-9/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | ZIUTWVSOYBYOJZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|