About N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide
N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide (PubChem CID 140969073) has the molecular formula C11H20N2OS
and a molecular weight of 228.36 g/mol. Its IUPAC name is N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide |
| PubChem CID | 140969073 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide |
| SMILES | CCCC1SC=CN1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H20N2OS/c1-5-6-9-13(7-8-15-9)10(14)12-11(2,3)4/h7-9H,5-6H2,1-4H3,(H,12,14) |
| InChIKey | BWUCBWMPSWKZKE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide?
The IUPAC name of N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide (CID 140969073) is N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide.
What is the SMILES notation for N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide?
The canonical SMILES for N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide is CCCC1SC=CN1C(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide?
The InChIKey is BWUCBWMPSWKZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2OS/c1-5-6-9-13(7-8-15-9)10(14)12-11(2,3)4/h7-9H,5-6H2,1-4H3,(H,12,14).
What are the key properties of N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide?
N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide has a molecular weight of 228.36 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-propyl-2H-1,3-thiazole-3-carboxamide is sourced from PubChem (CID 140969073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).