C14H18FNO — CID 140969182
3-(3,6-dihydro-2H-pyridin-1-yl)-1-(4-fluorophenyl)propan-1-ol (PubChem CID 140969182) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyridin-1-yl)-1-(4-fluorophenyl)propan-1-ol.
| Compound Name | 3-(3,6-dihydro-2H-pyridin-1-yl)-1-(4-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 140969182 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyridin-1-yl)-1-(4-fluorophenyl)propan-1-ol |
| SMILES | OC(CCN1CC=CCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FNO/c15-13-6-4-12(5-7-13)14(17)8-11-16-9-2-1-3-10-16/h1-2,4-7,14,17H,3,8-11H2 |
| InChIKey | SBTVCUPOHQCZBX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|