About 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione
8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione (PubChem CID 140969342) has the molecular formula C9H10N4S2
and a molecular weight of 238.34 g/mol. Its IUPAC name is 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione.
Molecular Properties
| Compound Name | 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione |
| PubChem CID | 140969342 |
| Molecular Formula | C9H10N4S2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione |
| SMILES | Cn1c(=S)[nH]c2nc(C3CC3)[nH]c2c1=S |
| InChI | InChI=1S/C9H10N4S2/c1-13-8(14)5-7(12-9(13)15)11-6(10-5)4-2-3-4/h4H,2-3H2,1H3,(H,10,11)(H,12,15) |
| InChIKey | VKBQKOCVMYPOGN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione?
The IUPAC name of 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione (CID 140969342) is 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione.
What is the SMILES notation for 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione?
The canonical SMILES for 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione is Cn1c(=S)[nH]c2nc(C3CC3)[nH]c2c1=S.
What is the InChIKey of 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione?
The InChIKey is VKBQKOCVMYPOGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4S2/c1-13-8(14)5-7(12-9(13)15)11-6(10-5)4-2-3-4/h4H,2-3H2,1H3,(H,10,11)(H,12,15).
What are the key properties of 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione?
8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione has a molecular weight of 238.34 g/mol, XLogP of 2.57, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopropyl-1-methyl-3,7-dihydropurine-2,6-dithione is sourced from PubChem (CID 140969342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).