About isoindol-3a-amine
isoindol-3a-amine (PubChem CID 140969596) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is isoindol-3a-amine.
Molecular Properties
| Compound Name | isoindol-3a-amine |
| PubChem CID | 140969596 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | isoindol-3a-amine |
| SMILES | NC12C=CC=CC1=CN=C2 |
| InChI | InChI=1S/C8H8N2/c9-8-4-2-1-3-7(8)5-10-6-8/h1-6H,9H2 |
| InChIKey | RLFYGDUIHRKPOB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze isoindol-3a-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoindol-3a-amine?
The IUPAC name of isoindol-3a-amine (CID 140969596) is isoindol-3a-amine.
What is the SMILES notation for isoindol-3a-amine?
The canonical SMILES for isoindol-3a-amine is NC12C=CC=CC1=CN=C2.
What is the InChIKey of isoindol-3a-amine?
The InChIKey is RLFYGDUIHRKPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c9-8-4-2-1-3-7(8)5-10-6-8/h1-6H,9H2.
What are the key properties of isoindol-3a-amine?
isoindol-3a-amine has a molecular weight of 132.17 g/mol, XLogP of 0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isoindol-3a-amine is sourced from PubChem (CID 140969596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).