About 1-oxo-1,3-benzothiazol-6-ol
1-oxo-1,3-benzothiazol-6-ol (PubChem CID 140970655) has the molecular formula C7H5NO2S
and a molecular weight of 167.19 g/mol. Its IUPAC name is 1-oxo-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 1-oxo-1,3-benzothiazol-6-ol |
| PubChem CID | 140970655 |
| Molecular Formula | C7H5NO2S |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | 1-oxo-1,3-benzothiazol-6-ol |
| SMILES | O=S1C=Nc2ccc(O)cc21 |
| InChI | InChI=1S/C7H5NO2S/c9-5-1-2-6-7(3-5)11(10)4-8-6/h1-4,9H |
| InChIKey | KJTIXPZAEDPUDJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-oxo-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-1,3-benzothiazol-6-ol?
The IUPAC name of 1-oxo-1,3-benzothiazol-6-ol (CID 140970655) is 1-oxo-1,3-benzothiazol-6-ol.
What is the SMILES notation for 1-oxo-1,3-benzothiazol-6-ol?
The canonical SMILES for 1-oxo-1,3-benzothiazol-6-ol is O=S1C=Nc2ccc(O)cc21.
What is the InChIKey of 1-oxo-1,3-benzothiazol-6-ol?
The InChIKey is KJTIXPZAEDPUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2S/c9-5-1-2-6-7(3-5)11(10)4-8-6/h1-4,9H.
What are the key properties of 1-oxo-1,3-benzothiazol-6-ol?
1-oxo-1,3-benzothiazol-6-ol has a molecular weight of 167.19 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-1,3-benzothiazol-6-ol is sourced from PubChem (CID 140970655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).