About 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol
2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol (PubChem CID 140971103) has the molecular formula C10H12F3NO
and a molecular weight of 219.21 g/mol. Its IUPAC name is 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol.
Molecular Properties
| Compound Name | 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol |
| PubChem CID | 140971103 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol |
| SMILES | NC(O)(CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO/c11-10(12,13)9(14,15)7-6-8-4-2-1-3-5-8/h1-5,15H,6-7,14H2 |
| InChIKey | FLMPCDRRCCFCEG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol?
The IUPAC name of 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol (CID 140971103) is 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol.
What is the SMILES notation for 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol?
The canonical SMILES for 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol is NC(O)(CCc1ccccc1)C(F)(F)F.
What is the InChIKey of 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol?
The InChIKey is FLMPCDRRCCFCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3NO/c11-10(12,13)9(14,15)7-6-8-4-2-1-3-5-8/h1-5,15H,6-7,14H2.
What are the key properties of 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol?
2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol has a molecular weight of 219.21 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,1,1-trifluoro-4-phenylbutan-2-ol is sourced from PubChem (CID 140971103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).