C12H15ClN2O3 — CID 140971708
ethyl 2-(5-amino-7-chloro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetate (PubChem CID 140971708) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is ethyl 2-(5-amino-7-chloro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetate.
| Compound Name | ethyl 2-(5-amino-7-chloro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetate |
|---|---|
| PubChem CID | 140971708 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | ethyl 2-(5-amino-7-chloro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetate |
| SMILES | CCOC(=O)CC1COc2cc(Cl)cc(N)c2N1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-2-17-11(16)5-8-6-18-10-4-7(13)3-9(14)12(10)15-8/h3-4,8,15H,2,5-6,14H2,1H3 |
| InChIKey | GJTDXQHQEIJZJD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|