About 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide
2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide (PubChem CID 140971816) has the molecular formula C8H12F3NO2
and a molecular weight of 211.18 g/mol. Its IUPAC name is 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide.
Molecular Properties
| Compound Name | 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide |
| PubChem CID | 140971816 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide |
| SMILES | CCC(O)C(=O)NCCC(F)=C(F)F |
| InChI | InChI=1S/C8H12F3NO2/c1-2-6(13)8(14)12-4-3-5(9)7(10)11/h6,13H,2-4H2,1H3,(H,12,14) |
| InChIKey | XWMODMYLFHXZOR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide?
The IUPAC name of 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide (CID 140971816) is 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide.
What is the SMILES notation for 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide?
The canonical SMILES for 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide is CCC(O)C(=O)NCCC(F)=C(F)F.
What is the InChIKey of 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide?
The InChIKey is XWMODMYLFHXZOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO2/c1-2-6(13)8(14)12-4-3-5(9)7(10)11/h6,13H,2-4H2,1H3,(H,12,14).
What are the key properties of 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide?
2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide has a molecular weight of 211.18 g/mol, XLogP of 1.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-(3,4,4-trifluorobut-3-enyl)butanamide is sourced from PubChem (CID 140971816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).