C7H8N4O — CID 140972439
(1,4-dimethyl-6-oxopyrimidin-2-yl)cyanamide (PubChem CID 140972439) has the molecular formula C7H8N4O and a molecular weight of 164.17 g/mol. Its IUPAC name is (1,4-dimethyl-6-oxopyrimidin-2-yl)cyanamide.
| Compound Name | (1,4-dimethyl-6-oxopyrimidin-2-yl)cyanamide |
|---|---|
| PubChem CID | 140972439 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (1,4-dimethyl-6-oxopyrimidin-2-yl)cyanamide |
| SMILES | Cc1cc(=O)n(C)c(NC#N)n1 |
| InChI | InChI=1S/C7H8N4O/c1-5-3-6(12)11(2)7(10-5)9-4-8/h3H,1-2H3,(H,9,10) |
| InChIKey | PUNCCEGHSYIKNX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|