C13H18N2O4 — CID 140972457
2-(4-methoxybutoxy)benzene-1,4-dicarboxamide (PubChem CID 140972457) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(4-methoxybutoxy)benzene-1,4-dicarboxamide.
| Compound Name | 2-(4-methoxybutoxy)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 140972457 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(4-methoxybutoxy)benzene-1,4-dicarboxamide |
| SMILES | COCCCCOc1cc(C(N)=O)ccc1C(N)=O |
| InChI | InChI=1S/C13H18N2O4/c1-18-6-2-3-7-19-11-8-9(12(14)16)4-5-10(11)13(15)17/h4-5,8H,2-3,6-7H2,1H3,(H2,14,16)(H2,15,17) |
| InChIKey | QJYNFSLPEFEHPD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|