C8H14O5 — CID 140973492
(3R,4S,5S)-5-(3-deuterio-1-hydroxybut-1-enyl)oxolane-2,3,4-triol (PubChem CID 140973492) has the molecular formula C8H14O5 and a molecular weight of 191.20 g/mol. Its IUPAC name is (3R,4S,5S)-5-(3-deuterio-1-hydroxybut-1-enyl)oxolane-2,3,4-triol.
| Compound Name | (3R,4S,5S)-5-(3-deuterio-1-hydroxybut-1-enyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 140973492 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3R,4S,5S)-5-(3-deuterio-1-hydroxybut-1-enyl)oxolane-2,3,4-triol |
| SMILES | [2H]C(C)C=C(O)[C@H]1OC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14O5/c1-2-3-4(9)7-5(10)6(11)8(12)13-7/h3,5-12H,2H2,1H3/t5-,6+,7+,8?/m0/s1/i2D/t2?,5-,6+,7+,8? |
| InChIKey | XMDGCMZBBWGXOG-VLJCXDCASA-N |
| XLogP | -0.72 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|