C24H50N4 — CID 140973554
4-[1-(1-amino-2,2,6,6-tetramethylpiperidin-4-yl)hexyl]-2,2,6,6-tetramethylpiperidin-1-amine (PubChem CID 140973554) has the molecular formula C24H50N4 and a molecular weight of 394.69 g/mol. Its IUPAC name is 4-[1-(1-amino-2,2,6,6-tetramethylpiperidin-4-yl)hexyl]-2,2,6,6-tetramethylpiperidin-1-amine.
| Compound Name | 4-[1-(1-amino-2,2,6,6-tetramethylpiperidin-4-yl)hexyl]-2,2,6,6-tetramethylpiperidin-1-amine |
|---|---|
| PubChem CID | 140973554 |
| Molecular Formula | C24H50N4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.40 |
| IUPAC Name | 4-[1-(1-amino-2,2,6,6-tetramethylpiperidin-4-yl)hexyl]-2,2,6,6-tetramethylpiperidin-1-amine |
| SMILES | CCCCCC(C1CC(C)(C)N(N)C(C)(C)C1)C1CC(C)(C)N(N)C(C)(C)C1 |
| InChI | InChI=1S/C24H50N4/c1-10-11-12-13-20(18-14-21(2,3)27(25)22(4,5)15-18)19-16-23(6,7)28(26)24(8,9)17-19/h18-20H,10-17,25-26H2,1-9H3 |
| InChIKey | ZSQQJSANYKRBNC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|