C13H13F3O2 — CID 140973775
6-methyl-2-(2,2,2-trifluoroacetyl)-3,4,4a,5-tetrahydro-2H-naphthalen-1-one (PubChem CID 140973775) has the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is 6-methyl-2-(2,2,2-trifluoroacetyl)-3,4,4a,5-tetrahydro-2H-naphthalen-1-one.
| Compound Name | 6-methyl-2-(2,2,2-trifluoroacetyl)-3,4,4a,5-tetrahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 140973775 |
| Molecular Formula | C13H13F3O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 6-methyl-2-(2,2,2-trifluoroacetyl)-3,4,4a,5-tetrahydro-2H-naphthalen-1-one |
| SMILES | CC1=CC=C2C(=O)C(C(=O)C(F)(F)F)CCC2C1 |
| InChI | InChI=1S/C13H13F3O2/c1-7-2-4-9-8(6-7)3-5-10(11(9)17)12(18)13(14,15)16/h2,4,8,10H,3,5-6H2,1H3 |
| InChIKey | AOGFYBHBPWGRTR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|