About trisodium;borate;tetrahydrate
trisodium;borate;tetrahydrate (PubChem CID 140973993) has the molecular formula H8BNa3O7
and a molecular weight of 199.84 g/mol. Its IUPAC name is trisodium;borate;tetrahydrate.
Molecular Properties
| Compound Name | trisodium;borate;tetrahydrate |
| PubChem CID | 140973993 |
| Molecular Formula | H8BNa3O7 |
| Molecular Weight | 199.84 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | trisodium;borate;tetrahydrate |
| SMILES | O.O.O.O.[Na+].[Na+].[Na+].[O-]B([O-])[O-] |
| InChI | InChI=1S/BO3.3Na.4H2O/c2-1(3)4;;;;;;;/h;;;;4*1H2/q-3;3*+1;;;; |
| InChIKey | KFVREYFOFOLMIE-UHFFFAOYSA-N |
| XLogP | -16.23 |
| TPSA | 195.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.84 |
| LogP ≤ 5 | -16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trisodium;borate;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;borate;tetrahydrate?
The IUPAC name of trisodium;borate;tetrahydrate (CID 140973993) is trisodium;borate;tetrahydrate.
What is the SMILES notation for trisodium;borate;tetrahydrate?
The canonical SMILES for trisodium;borate;tetrahydrate is O.O.O.O.[Na+].[Na+].[Na+].[O-]B([O-])[O-].
What is the InChIKey of trisodium;borate;tetrahydrate?
The InChIKey is KFVREYFOFOLMIE-UHFFFAOYSA-N. The full InChI is InChI=1S/BO3.3Na.4H2O/c2-1(3)4;;;;;;;/h;;;;4*1H2/q-3;3*+1;;;;.
What are the key properties of trisodium;borate;tetrahydrate?
trisodium;borate;tetrahydrate has a molecular weight of 199.84 g/mol, XLogP of -16.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;borate;tetrahydrate is sourced from PubChem (CID 140973993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).