C22H27NO11 — CID 140974184
[(2R,3R,4S,5R)-6-anilino-2,3,4,5-tetrakis[(2-deuterioacetyl)oxy]-6-oxohexyl] 2-deuterioacetate (PubChem CID 140974184) has the molecular formula C22H27NO11 and a molecular weight of 486.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-anilino-2,3,4,5-tetrakis[(2-deuterioacetyl)oxy]-6-oxohexyl] 2-deuterioacetate.
| Compound Name | [(2R,3R,4S,5R)-6-anilino-2,3,4,5-tetrakis[(2-deuterioacetyl)oxy]-6-oxohexyl] 2-deuterioacetate |
|---|---|
| PubChem CID | 140974184 |
| Molecular Formula | C22H27NO11 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [(2R,3R,4S,5R)-6-anilino-2,3,4,5-tetrakis[(2-deuterioacetyl)oxy]-6-oxohexyl] 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H27NO11/c1-12(24)30-11-18(31-13(2)25)19(32-14(3)26)20(33-15(4)27)21(34-16(5)28)22(29)23-17-9-7-6-8-10-17/h6-10,18-21H,11H2,1-5H3,(H,23,29)/t18-,19-,20+,21-/m1/s1/i1D,2D,3D,4D,5D |
| InChIKey | UOVCYSVLSRDMIY-XGTSMNQSSA-N |
| XLogP | 0.92 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|