About 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol
4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol (PubChem CID 140974207) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol.
Molecular Properties
| Compound Name | 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol |
| PubChem CID | 140974207 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol |
| SMILES | OCCOC1=CC(O)Nc2ccccc21 |
| InChI | InChI=1S/C11H13NO3/c13-5-6-15-10-7-11(14)12-9-4-2-1-3-8(9)10/h1-4,7,11-14H,5-6H2 |
| InChIKey | CUUFHAJGFLQUIQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol?
The IUPAC name of 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol (CID 140974207) is 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol.
What is the SMILES notation for 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol?
The canonical SMILES for 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol is OCCOC1=CC(O)Nc2ccccc21.
What is the InChIKey of 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol?
The InChIKey is CUUFHAJGFLQUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c13-5-6-15-10-7-11(14)12-9-4-2-1-3-8(9)10/h1-4,7,11-14H,5-6H2.
What are the key properties of 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol?
4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol has a molecular weight of 207.23 g/mol, XLogP of 0.78, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethoxy)-1,2-dihydroquinolin-2-ol is sourced from PubChem (CID 140974207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).