C9H9BrO — CID 140974363
2-bromo-2,3,4,5-tetrahydroinden-1-one (PubChem CID 140974363) has the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. Its IUPAC name is 2-bromo-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | 2-bromo-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 140974363 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 2-bromo-2,3,4,5-tetrahydroinden-1-one |
| SMILES | O=C1C2=C(CCC=C2)CC1Br |
| InChI | InChI=1S/C9H9BrO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h2,4,8H,1,3,5H2 |
| InChIKey | JMLFIWKMCHIFDN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|