C8H14N2O — CID 140974406
2-methyl-1,2,3,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-4-one (PubChem CID 140974406) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-methyl-1,2,3,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-4-one.
| Compound Name | 2-methyl-1,2,3,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-4-one |
|---|---|
| PubChem CID | 140974406 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-methyl-1,2,3,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-4-one |
| SMILES | CC1CC(=O)C2CNCC2N1 |
| InChI | InChI=1S/C8H14N2O/c1-5-2-8(11)6-3-9-4-7(6)10-5/h5-7,9-10H,2-4H2,1H3 |
| InChIKey | ONFJETVGDUJYKC-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |