About 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole
1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole (PubChem CID 140974510) has the molecular formula C17H19F2NO
and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole.
Molecular Properties
| Compound Name | 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole |
| PubChem CID | 140974510 |
| Molecular Formula | C17H19F2NO |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole |
| SMILES | C/C=C/Cn1ccc(COCc2c(F)cccc2F)c1C |
| InChI | InChI=1S/C17H19F2NO/c1-3-4-9-20-10-8-14(13(20)2)11-21-12-15-16(18)6-5-7-17(15)19/h3-8,10H,9,11-12H2,1-2H3/b4-3+ |
| InChIKey | ZHJPZJLIXACRGY-ONEGZZNKSA-N |
| XLogP | 4.37 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole?
The IUPAC name of 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole (CID 140974510) is 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole.
What is the SMILES notation for 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole?
The canonical SMILES for 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole is C/C=C/Cn1ccc(COCc2c(F)cccc2F)c1C.
What is the InChIKey of 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole?
The InChIKey is ZHJPZJLIXACRGY-ONEGZZNKSA-N. The full InChI is InChI=1S/C17H19F2NO/c1-3-4-9-20-10-8-14(13(20)2)11-21-12-15-16(18)6-5-7-17(15)19/h3-8,10H,9,11-12H2,1-2H3/b4-3+.
What are the key properties of 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole?
1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole has a molecular weight of 291.34 g/mol, XLogP of 4.37, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-2-enyl]-3-[(2,6-difluorophenyl)methoxymethyl]-2-methylpyrrole is sourced from PubChem (CID 140974510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).