About 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole
1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole (PubChem CID 140974522) has the molecular formula C16H17F2NO
and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole |
| PubChem CID | 140974522 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole |
| SMILES | C=C(Cn1ccc(C)c1C)OCc1ccc(F)cc1F |
| InChI | InChI=1S/C16H17F2NO/c1-11-6-7-19(13(11)3)9-12(2)20-10-14-4-5-15(17)8-16(14)18/h4-8H,2,9-10H2,1,3H3 |
| InChIKey | BJMJWVZOVUINOH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole?
The IUPAC name of 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole (CID 140974522) is 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole.
What is the SMILES notation for 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole?
The canonical SMILES for 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole is C=C(Cn1ccc(C)c1C)OCc1ccc(F)cc1F.
What is the InChIKey of 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole?
The InChIKey is BJMJWVZOVUINOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2NO/c1-11-6-7-19(13(11)3)9-12(2)20-10-14-4-5-15(17)8-16(14)18/h4-8H,2,9-10H2,1,3H3.
What are the key properties of 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole?
1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole has a molecular weight of 277.31 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2,4-difluorophenyl)methoxy]prop-2-enyl]-2,3-dimethylpyrrole is sourced from PubChem (CID 140974522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).