C20H38O8S2 — CID 140975945
2,3-bis(octylsulfonyl)butanedioic acid (PubChem CID 140975945) has the molecular formula C20H38O8S2 and a molecular weight of 470.65 g/mol. Its IUPAC name is 2,3-bis(octylsulfonyl)butanedioic acid.
| Compound Name | 2,3-bis(octylsulfonyl)butanedioic acid |
|---|---|
| PubChem CID | 140975945 |
| Molecular Formula | C20H38O8S2 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2,3-bis(octylsulfonyl)butanedioic acid |
| SMILES | CCCCCCCCS(=O)(=O)C(C(=O)O)C(C(=O)O)S(=O)(=O)CCCCCCCC |
| InChI | InChI=1S/C20H38O8S2/c1-3-5-7-9-11-13-15-29(25,26)17(19(21)22)18(20(23)24)30(27,28)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | SGZYLUFRQCYVHZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|