About spiro[5.5]undecane-2,2,4,4-tetrol
spiro[5.5]undecane-2,2,4,4-tetrol (PubChem CID 140976072) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is spiro[5.5]undecane-2,2,4,4-tetrol.
Molecular Properties
| Compound Name | spiro[5.5]undecane-2,2,4,4-tetrol |
| PubChem CID | 140976072 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | spiro[5.5]undecane-2,2,4,4-tetrol |
| SMILES | OC1(O)CC(O)(O)CC2(CCCCC2)C1 |
| InChI | InChI=1S/C11H20O4/c12-10(13)6-9(4-2-1-3-5-9)7-11(14,15)8-10/h12-15H,1-8H2 |
| InChIKey | BCJDNKIDDMQQRV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze spiro[5.5]undecane-2,2,4,4-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[5.5]undecane-2,2,4,4-tetrol?
The IUPAC name of spiro[5.5]undecane-2,2,4,4-tetrol (CID 140976072) is spiro[5.5]undecane-2,2,4,4-tetrol.
What is the SMILES notation for spiro[5.5]undecane-2,2,4,4-tetrol?
The canonical SMILES for spiro[5.5]undecane-2,2,4,4-tetrol is OC1(O)CC(O)(O)CC2(CCCCC2)C1.
What is the InChIKey of spiro[5.5]undecane-2,2,4,4-tetrol?
The InChIKey is BCJDNKIDDMQQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c12-10(13)6-9(4-2-1-3-5-9)7-11(14,15)8-10/h12-15H,1-8H2.
What are the key properties of spiro[5.5]undecane-2,2,4,4-tetrol?
spiro[5.5]undecane-2,2,4,4-tetrol has a molecular weight of 216.28 g/mol, XLogP of 0.48, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[5.5]undecane-2,2,4,4-tetrol is sourced from PubChem (CID 140976072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).