C9H18N4O — CID 140976479
1,3-dipyrrolidin-1-ylurea (PubChem CID 140976479) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,3-dipyrrolidin-1-ylurea.
| Compound Name | 1,3-dipyrrolidin-1-ylurea |
|---|---|
| PubChem CID | 140976479 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 1,3-dipyrrolidin-1-ylurea |
| SMILES | O=C(NN1CCCC1)NN1CCCC1 |
| InChI | InChI=1S/C9H18N4O/c14-9(10-12-5-1-2-6-12)11-13-7-3-4-8-13/h1-8H2,(H2,10,11,14) |
| InChIKey | JLSWNXHRDRASFV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |