About 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione
5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione (PubChem CID 1409765) has the molecular formula C15H8Cl2N2O3
and a molecular weight of 335.15 g/mol. Its IUPAC name is 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione |
| PubChem CID | 1409765 |
| Molecular Formula | C15H8Cl2N2O3 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(/N=C/c3cc(Cl)cc(Cl)c3O)ccc21 |
| InChI | InChI=1S/C15H8Cl2N2O3/c16-8-3-7(13(20)12(17)4-8)6-18-9-1-2-10-11(5-9)15(22)19-14(10)21/h1-6,20H,(H,19,21,22)/b18-6+ |
| InChIKey | LFWZPJQAMNHTSB-NGYBGAFCSA-N |
| XLogP | 3.33 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione?
The IUPAC name of 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione (CID 1409765) is 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione.
What is the SMILES notation for 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione?
The canonical SMILES for 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione is O=C1NC(=O)c2cc(/N=C/c3cc(Cl)cc(Cl)c3O)ccc21.
What is the InChIKey of 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione?
The InChIKey is LFWZPJQAMNHTSB-NGYBGAFCSA-N. The full InChI is InChI=1S/C15H8Cl2N2O3/c16-8-3-7(13(20)12(17)4-8)6-18-9-1-2-10-11(5-9)15(22)19-14(10)21/h1-6,20H,(H,19,21,22)/b18-6+.
What are the key properties of 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione?
5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione has a molecular weight of 335.15 g/mol, XLogP of 3.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]isoindole-1,3-dione is sourced from PubChem (CID 1409765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).