About 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol
4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol (PubChem CID 140977045) has the molecular formula C10H13FN2O2
and a molecular weight of 212.22 g/mol. Its IUPAC name is 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol.
Molecular Properties
| Compound Name | 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol |
| PubChem CID | 140977045 |
| Molecular Formula | C10H13FN2O2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol |
| SMILES | CCN1c2cc(F)ccc2NC(O)C1O |
| InChI | InChI=1S/C10H13FN2O2/c1-2-13-8-5-6(11)3-4-7(8)12-9(14)10(13)15/h3-5,9-10,12,14-15H,2H2,1H3 |
| InChIKey | YONBUDFFSMNOKI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol?
The IUPAC name of 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol (CID 140977045) is 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol.
What is the SMILES notation for 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol?
The canonical SMILES for 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol is CCN1c2cc(F)ccc2NC(O)C1O.
What is the InChIKey of 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol?
The InChIKey is YONBUDFFSMNOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN2O2/c1-2-13-8-5-6(11)3-4-7(8)12-9(14)10(13)15/h3-5,9-10,12,14-15H,2H2,1H3.
What are the key properties of 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol?
4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol has a molecular weight of 212.22 g/mol, XLogP of 0.71, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-fluoro-2,3-dihydro-1H-quinoxaline-2,3-diol is sourced from PubChem (CID 140977045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).