C17H23F3N4O — CID 140977075
2,2,2-trifluoro-1-[4-(2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-6-ylmethyl)piperidin-1-yl]ethanone (PubChem CID 140977075) has the molecular formula C17H23F3N4O and a molecular weight of 356.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-6-ylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-(2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-6-ylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 140977075 |
| Molecular Formula | C17H23F3N4O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-6-ylmethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(N1CCC(CN2CC3C=CC=C4NCC(C2)N43)CC1)C(F)(F)F |
| InChI | InChI=1S/C17H23F3N4O/c18-17(19,20)16(25)23-6-4-12(5-7-23)9-22-10-13-2-1-3-15-21-8-14(11-22)24(13)15/h1-3,12-14,21H,4-11H2 |
| InChIKey | GTSWXWPDLAZKGL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |