About (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol
(3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol (PubChem CID 140977890) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol.
Molecular Properties
| Compound Name | (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol |
| PubChem CID | 140977890 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol |
| SMILES | Cc1cc(/C=C2/c3ccccc3NC2O)oc1C |
| InChI | InChI=1S/C15H15NO2/c1-9-7-11(18-10(9)2)8-13-12-5-3-4-6-14(12)16-15(13)17/h3-8,15-17H,1-2H3/b13-8- |
| InChIKey | IAFUWQHIAXXYDU-JYRVWZFOSA-N |
| XLogP | 3.18 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol?
The IUPAC name of (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol (CID 140977890) is (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol.
What is the SMILES notation for (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol?
The canonical SMILES for (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol is Cc1cc(/C=C2/c3ccccc3NC2O)oc1C.
What is the InChIKey of (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol?
The InChIKey is IAFUWQHIAXXYDU-JYRVWZFOSA-N. The full InChI is InChI=1S/C15H15NO2/c1-9-7-11(18-10(9)2)8-13-12-5-3-4-6-14(12)16-15(13)17/h3-8,15-17H,1-2H3/b13-8-.
What are the key properties of (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol?
(3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol has a molecular weight of 241.29 g/mol, XLogP of 3.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(4,5-dimethylfuran-2-yl)methylidene]-1,2-dihydroindol-2-ol is sourced from PubChem (CID 140977890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).