About (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol
(3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol (PubChem CID 140977899) has the molecular formula C12H10N2OS
and a molecular weight of 230.29 g/mol. Its IUPAC name is (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol.
Molecular Properties
| Compound Name | (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol |
| PubChem CID | 140977899 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol |
| SMILES | OC1Nc2ccccc2/C1=C/c1cscn1 |
| InChI | InChI=1S/C12H10N2OS/c15-12-10(5-8-6-16-7-13-8)9-3-1-2-4-11(9)14-12/h1-7,12,14-15H/b10-5- |
| InChIKey | UYGVZQXZWXCPNY-YHYXMXQVSA-N |
| XLogP | 2.43 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol?
The IUPAC name of (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol (CID 140977899) is (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol.
What is the SMILES notation for (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol?
The canonical SMILES for (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol is OC1Nc2ccccc2/C1=C/c1cscn1.
What is the InChIKey of (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol?
The InChIKey is UYGVZQXZWXCPNY-YHYXMXQVSA-N. The full InChI is InChI=1S/C12H10N2OS/c15-12-10(5-8-6-16-7-13-8)9-3-1-2-4-11(9)14-12/h1-7,12,14-15H/b10-5-.
What are the key properties of (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol?
(3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol has a molecular weight of 230.29 g/mol, XLogP of 2.43, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(1,3-thiazol-4-ylmethylidene)-1,2-dihydroindol-2-ol is sourced from PubChem (CID 140977899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).