About [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate
[(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate (PubChem CID 14097836) has the molecular formula C8H8ClNO5
and a molecular weight of 233.61 g/mol. Its IUPAC name is [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate |
| PubChem CID | 14097836 |
| Molecular Formula | C8H8ClNO5 |
| Molecular Weight | 233.61 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)N(CC(=O)Cl)C1=O |
| InChI | InChI=1S/C8H8ClNO5/c1-4(11)15-5-2-7(13)10(8(5)14)3-6(9)12/h5H,2-3H2,1H3/t5-/m0/s1 |
| InChIKey | DXERMFDRGZAWEW-YFKPBYRVSA-N |
| XLogP | -0.56 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.61 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate?
The IUPAC name of [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate (CID 14097836) is [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate.
What is the SMILES notation for [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate?
The canonical SMILES for [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate is CC(=O)O[C@H]1CC(=O)N(CC(=O)Cl)C1=O.
What is the InChIKey of [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate?
The InChIKey is DXERMFDRGZAWEW-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H8ClNO5/c1-4(11)15-5-2-7(13)10(8(5)14)3-6(9)12/h5H,2-3H2,1H3/t5-/m0/s1.
What are the key properties of [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate?
[(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate has a molecular weight of 233.61 g/mol, XLogP of -0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-(2-chloro-2-oxoethyl)-2,5-dioxopyrrolidin-3-yl] acetate is sourced from PubChem (CID 14097836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).