C20H26ClO5PS — CID 140978801
[butoxy(3-phenylpropyl)phosphoryl]methyl 4-chlorobenzenesulfonate (PubChem CID 140978801) has the molecular formula C20H26ClO5PS and a molecular weight of 444.92 g/mol. Its IUPAC name is [butoxy(3-phenylpropyl)phosphoryl]methyl 4-chlorobenzenesulfonate.
| Compound Name | [butoxy(3-phenylpropyl)phosphoryl]methyl 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 140978801 |
| Molecular Formula | C20H26ClO5PS |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | [butoxy(3-phenylpropyl)phosphoryl]methyl 4-chlorobenzenesulfonate |
| SMILES | CCCCOP(=O)(CCCc1ccccc1)COS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClO5PS/c1-2-3-15-25-27(22,16-7-10-18-8-5-4-6-9-18)17-26-28(23,24)20-13-11-19(21)12-14-20/h4-6,8-9,11-14H,2-3,7,10,15-17H2,1H3 |
| InChIKey | DPCKJOSYTOQLHE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|