About 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride
5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride (PubChem CID 14097926) has the molecular formula C19H24ClNO3S
and a molecular weight of 381.93 g/mol. Its IUPAC name is 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride |
| PubChem CID | 14097926 |
| Molecular Formula | C19H24ClNO3S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride |
| SMILES | CN(C)CCCCCOc1cccc2c1S(=O)(=O)c1ccccc1-2.Cl |
| InChI | InChI=1S/C19H23NO3S.ClH/c1-20(2)13-6-3-7-14-23-17-11-8-10-16-15-9-4-5-12-18(15)24(21,22)19(16)17;/h4-5,8-12H,3,6-7,13-14H2,1-2H3;1H |
| InChIKey | QFGXYAFSYLWKOL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride?
The IUPAC name of 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride (CID 14097926) is 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride.
What is the SMILES notation for 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride?
The canonical SMILES for 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride is CN(C)CCCCCOc1cccc2c1S(=O)(=O)c1ccccc1-2.Cl.
What is the InChIKey of 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride?
The InChIKey is QFGXYAFSYLWKOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO3S.ClH/c1-20(2)13-6-3-7-14-23-17-11-8-10-16-15-9-4-5-12-18(15)24(21,22)19(16)17;/h4-5,8-12H,3,6-7,13-14H2,1-2H3;1H.
What are the key properties of 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride?
5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride has a molecular weight of 381.93 g/mol, XLogP of 4.03, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,5-dioxodibenzothiophen-4-yl)oxy-N,N-dimethylpentan-1-amine;hydrochloride is sourced from PubChem (CID 14097926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).