C21H35NO4 — CID 140979955
benzyl N-[(2S,3S)-1,3-dihydroxytridecan-2-yl]carbamate (PubChem CID 140979955) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-1,3-dihydroxytridecan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-1,3-dihydroxytridecan-2-yl]carbamate |
|---|---|
| PubChem CID | 140979955 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | benzyl N-[(2S,3S)-1,3-dihydroxytridecan-2-yl]carbamate |
| SMILES | CCCCCCCCCC[C@H](O)[C@H](CO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H35NO4/c1-2-3-4-5-6-7-8-12-15-20(24)19(16-23)22-21(25)26-17-18-13-10-9-11-14-18/h9-11,13-14,19-20,23-24H,2-8,12,15-17H2,1H3,(H,22,25)/t19-,20-/m0/s1 |
| InChIKey | FLVGPGKNIXESTI-PMACEKPBSA-N |
| XLogP | 4.17 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|