C12H10N4OS — CID 140979991
2-(3-methoxyphenyl)sulfanyl-7H-purine (PubChem CID 140979991) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)sulfanyl-7H-purine.
| Compound Name | 2-(3-methoxyphenyl)sulfanyl-7H-purine |
|---|---|
| PubChem CID | 140979991 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-(3-methoxyphenyl)sulfanyl-7H-purine |
| SMILES | COc1cccc(Sc2ncc3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C12H10N4OS/c1-17-8-3-2-4-9(5-8)18-12-13-6-10-11(16-12)15-7-14-10/h2-7H,1H3,(H,13,14,15,16) |
| InChIKey | ROLDIXKGZWALBO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |