C6H10N2O2S — CID 140981655
N-methyl-2-(4-oxo-1,3-thiazolidin-2-yl)acetamide (PubChem CID 140981655) has the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. Its IUPAC name is N-methyl-2-(4-oxo-1,3-thiazolidin-2-yl)acetamide.
| Compound Name | N-methyl-2-(4-oxo-1,3-thiazolidin-2-yl)acetamide |
|---|---|
| PubChem CID | 140981655 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | N-methyl-2-(4-oxo-1,3-thiazolidin-2-yl)acetamide |
| SMILES | CNC(=O)CC1NC(=O)CS1 |
| InChI | InChI=1S/C6H10N2O2S/c1-7-4(9)2-6-8-5(10)3-11-6/h6H,2-3H2,1H3,(H,7,9)(H,8,10) |
| InChIKey | WUSPTFWUMQNPKC-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |