About N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine
N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine (PubChem CID 140981931) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine |
| PubChem CID | 140981931 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine |
| SMILES | COC1=CC=CC(=NO)C1 |
| InChI | InChI=1S/C7H9NO2/c1-10-7-4-2-3-6(5-7)8-9/h2-4,9H,5H2,1H3 |
| InChIKey | UKUQPVCKTBDECX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine?
The IUPAC name of N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine (CID 140981931) is N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine.
What is the SMILES notation for N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine?
The canonical SMILES for N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine is COC1=CC=CC(=NO)C1.
What is the InChIKey of N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine?
The InChIKey is UKUQPVCKTBDECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-10-7-4-2-3-6(5-7)8-9/h2-4,9H,5H2,1H3.
What are the key properties of N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine?
N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine has a molecular weight of 139.15 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methoxycyclohexa-2,4-dien-1-ylidene)hydroxylamine is sourced from PubChem (CID 140981931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).