C12H9F2N3O2 — CID 140982208
N-[4-(3,4-difluorophenyl)-6-methyl-2-oxo-1H-pyrimidin-5-yl]formamide (PubChem CID 140982208) has the molecular formula C12H9F2N3O2 and a molecular weight of 265.22 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-6-methyl-2-oxo-1H-pyrimidin-5-yl]formamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-6-methyl-2-oxo-1H-pyrimidin-5-yl]formamide |
|---|---|
| PubChem CID | 140982208 |
| Molecular Formula | C12H9F2N3O2 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-6-methyl-2-oxo-1H-pyrimidin-5-yl]formamide |
| SMILES | Cc1[nH]c(=O)nc(-c2ccc(F)c(F)c2)c1NC=O |
| InChI | InChI=1S/C12H9F2N3O2/c1-6-10(15-5-18)11(17-12(19)16-6)7-2-3-8(13)9(14)4-7/h2-5H,1H3,(H,15,18)(H,16,17,19) |
| InChIKey | OGABVWFIPSIWAC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|