C12H14N2O — CID 140982982
2,2-dimethylquinoline-1-carboxamide (PubChem CID 140982982) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2,2-dimethylquinoline-1-carboxamide.
| Compound Name | 2,2-dimethylquinoline-1-carboxamide |
|---|---|
| PubChem CID | 140982982 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2,2-dimethylquinoline-1-carboxamide |
| SMILES | CC1(C)C=Cc2ccccc2N1C(N)=O |
| InChI | InChI=1S/C12H14N2O/c1-12(2)8-7-9-5-3-4-6-10(9)14(12)11(13)15/h3-8H,1-2H3,(H2,13,15) |
| InChIKey | LZTMOKMTJGNHCP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |