C23H31NO3 — CID 140983151
tert-butyl N-[1-[2-(hydroxymethyl)phenyl]-5-phenylpentan-3-yl]carbamate (PubChem CID 140983151) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(hydroxymethyl)phenyl]-5-phenylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(hydroxymethyl)phenyl]-5-phenylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 140983151 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | tert-butyl N-[1-[2-(hydroxymethyl)phenyl]-5-phenylpentan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCc1ccccc1)CCc1ccccc1CO |
| InChI | InChI=1S/C23H31NO3/c1-23(2,3)27-22(26)24-21(15-13-18-9-5-4-6-10-18)16-14-19-11-7-8-12-20(19)17-25/h4-12,21,25H,13-17H2,1-3H3,(H,24,26) |
| InChIKey | ZEUBFXSUFMSSDA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |