C17H18N2O6 — CID 140983490
dimethyl 2,6-dimethyl-4-nitro-1-phenyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 140983490) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-nitro-1-phenyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-nitro-1-phenyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 140983490 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-nitro-1-phenyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)C(C)=C(C(=O)OC)C1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O6/c1-10-13(16(20)24-3)15(19(22)23)14(17(21)25-4)11(2)18(10)12-8-6-5-7-9-12/h5-9,15H,1-4H3 |
| InChIKey | LKIWIXHBXCEWNK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|