C18H21F5N4O2 — CID 140983532
6-[[1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]methyl]-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-5-one (PubChem CID 140983532) has the molecular formula C18H21F5N4O2 and a molecular weight of 420.38 g/mol. Its IUPAC name is 6-[[1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]methyl]-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-5-one.
| Compound Name | 6-[[1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]methyl]-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-5-one |
|---|---|
| PubChem CID | 140983532 |
| Molecular Formula | C18H21F5N4O2 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 6-[[1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]methyl]-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-5-one |
| SMILES | O=C1C2CNC3=CC=CC(CN1CC1CCN(C(=O)C(F)(F)C(F)(F)F)CC1)N32 |
| InChI | InChI=1S/C18H21F5N4O2/c19-17(20,18(21,22)23)16(29)25-6-4-11(5-7-25)9-26-10-12-2-1-3-14-24-8-13(15(26)28)27(12)14/h1-3,11-13,24H,4-10H2 |
| InChIKey | AXOKFSWZRMYQHT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|