C14H19F3N4O3S — CID 140983540
1,1,1-trifluoro-N-[4-(5-oxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-6-yl)butyl]methanesulfonamide (PubChem CID 140983540) has the molecular formula C14H19F3N4O3S and a molecular weight of 380.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[4-(5-oxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-6-yl)butyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[4-(5-oxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-6-yl)butyl]methanesulfonamide |
|---|---|
| PubChem CID | 140983540 |
| Molecular Formula | C14H19F3N4O3S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1,1,1-trifluoro-N-[4-(5-oxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-dien-6-yl)butyl]methanesulfonamide |
| SMILES | O=C1C2CNC3=CC=CC(CN1CCCCNS(=O)(=O)C(F)(F)F)N32 |
| InChI | InChI=1S/C14H19F3N4O3S/c15-14(16,17)25(23,24)19-6-1-2-7-20-9-10-4-3-5-12-18-8-11(13(20)22)21(10)12/h3-5,10-11,18-19H,1-2,6-9H2 |
| InChIKey | SQJXZQWTJXVAQS-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|