About ethyl 5-amino-2-oxopentanoate
ethyl 5-amino-2-oxopentanoate (PubChem CID 140983644) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is ethyl 5-amino-2-oxopentanoate.
Molecular Properties
| Compound Name | ethyl 5-amino-2-oxopentanoate |
| PubChem CID | 140983644 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | ethyl 5-amino-2-oxopentanoate |
| SMILES | CCOC(=O)C(=O)CCCN |
| InChI | InChI=1S/C7H13NO3/c1-2-11-7(10)6(9)4-3-5-8/h2-5,8H2,1H3 |
| InChIKey | KZEDDSWXKBITMO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-amino-2-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-2-oxopentanoate?
The IUPAC name of ethyl 5-amino-2-oxopentanoate (CID 140983644) is ethyl 5-amino-2-oxopentanoate.
What is the SMILES notation for ethyl 5-amino-2-oxopentanoate?
The canonical SMILES for ethyl 5-amino-2-oxopentanoate is CCOC(=O)C(=O)CCCN.
What is the InChIKey of ethyl 5-amino-2-oxopentanoate?
The InChIKey is KZEDDSWXKBITMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-2-11-7(10)6(9)4-3-5-8/h2-5,8H2,1H3.
What are the key properties of ethyl 5-amino-2-oxopentanoate?
ethyl 5-amino-2-oxopentanoate has a molecular weight of 159.18 g/mol, XLogP of -0.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-2-oxopentanoate is sourced from PubChem (CID 140983644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).